C15H31NO5Si — CID 19379542
N,N-bis(oxiran-2-ylmethyl)-3-triethoxysilylpropan-1-amine (PubChem CID 19379542) has the molecular formula C15H31NO5Si and a molecular weight of 333.50 g/mol. Its IUPAC name is N,N-bis(oxiran-2-ylmethyl)-3-triethoxysilylpropan-1-amine.
| Compound Name | N,N-bis(oxiran-2-ylmethyl)-3-triethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 19379542 |
| Molecular Formula | C15H31NO5Si |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | N,N-bis(oxiran-2-ylmethyl)-3-triethoxysilylpropan-1-amine |
| SMILES | CCO[Si](CCCN(CC1CO1)CC1CO1)(OCC)OCC |
| InChI | InChI=1S/C15H31NO5Si/c1-4-19-22(20-5-2,21-6-3)9-7-8-16(10-14-12-17-14)11-15-13-18-15/h14-15H,4-13H2,1-3H3 |
| InChIKey | SZTIJNQKKSEUSN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|