C19H39NO4Si — CID 66743968
3-[diethoxy(ethyl)silyl]-N,N-bis(oxolan-2-ylmethyl)propan-1-amine (PubChem CID 66743968) has the molecular formula C19H39NO4Si and a molecular weight of 373.61 g/mol. Its IUPAC name is 3-[diethoxy(ethyl)silyl]-N,N-bis(oxolan-2-ylmethyl)propan-1-amine.
| Compound Name | 3-[diethoxy(ethyl)silyl]-N,N-bis(oxolan-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 66743968 |
| Molecular Formula | C19H39NO4Si |
| Molecular Weight | 373.61 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 3-[diethoxy(ethyl)silyl]-N,N-bis(oxolan-2-ylmethyl)propan-1-amine |
| SMILES | CCO[Si](CC)(CCCN(CC1CCCO1)CC1CCCO1)OCC |
| InChI | InChI=1S/C19H39NO4Si/c1-4-23-25(6-3,24-5-2)15-9-12-20(16-18-10-7-13-21-18)17-19-11-8-14-22-19/h18-19H,4-17H2,1-3H3 |
| InChIKey | XVPINBNEDNRPMB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.61 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|