C17H35NO4Si — CID 173014007
4-dimethoxysilyl-N,N-bis(oxolan-2-ylmethyl)pentan-1-amine (PubChem CID 173014007) has the molecular formula C17H35NO4Si and a molecular weight of 345.56 g/mol. Its IUPAC name is 4-dimethoxysilyl-N,N-bis(oxolan-2-ylmethyl)pentan-1-amine.
| Compound Name | 4-dimethoxysilyl-N,N-bis(oxolan-2-ylmethyl)pentan-1-amine |
|---|---|
| PubChem CID | 173014007 |
| Molecular Formula | C17H35NO4Si |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 4-dimethoxysilyl-N,N-bis(oxolan-2-ylmethyl)pentan-1-amine |
| SMILES | CO[SiH](OC)C(C)CCCN(CC1CCCO1)CC1CCCO1 |
| InChI | InChI=1S/C17H35NO4Si/c1-15(23(19-2)20-3)7-4-10-18(13-16-8-5-11-21-16)14-17-9-6-12-22-17/h15-17,23H,4-14H2,1-3H3 |
| InChIKey | AZARUSFDJGASMV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|