C7H15NO — CID 89026085
N,N-dimethyl-1-[(2S)-oxolan-2-yl]methanamine (PubChem CID 89026085) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is N,N-dimethyl-1-[(2S)-oxolan-2-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[(2S)-oxolan-2-yl]methanamine |
|---|---|
| PubChem CID | 89026085 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | N,N-dimethyl-1-[(2S)-oxolan-2-yl]methanamine |
| SMILES | CN(C)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C7H15NO/c1-8(2)6-7-4-3-5-9-7/h7H,3-6H2,1-2H3/t7-/m0/s1 |
| InChIKey | JKAJLDZOBJSTEW-ZETCQYMHSA-N |
| XLogP | 0.73 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |