C9H19NO2 — CID 103935026
(2S)-1-[methyl(oxolan-2-ylmethyl)amino]propan-2-ol (PubChem CID 103935026) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is (2S)-1-[methyl(oxolan-2-ylmethyl)amino]propan-2-ol.
| Compound Name | (2S)-1-[methyl(oxolan-2-ylmethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 103935026 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | (2S)-1-[methyl(oxolan-2-ylmethyl)amino]propan-2-ol |
| SMILES | C[C@H](O)CN(C)CC1CCCO1 |
| InChI | InChI=1S/C9H19NO2/c1-8(11)6-10(2)7-9-4-3-5-12-9/h8-9,11H,3-7H2,1-2H3/t8-,9?/m0/s1 |
| InChIKey | ABXCWBBYUUBPSZ-IENPIDJESA-N |
| XLogP | 0.48 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |