C16H23NO2 — CID 62613157
2-methyl-3-[methyl(oxolan-2-ylmethyl)amino]-1-phenylpropan-1-one (PubChem CID 62613157) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-methyl-3-[methyl(oxolan-2-ylmethyl)amino]-1-phenylpropan-1-one.
| Compound Name | 2-methyl-3-[methyl(oxolan-2-ylmethyl)amino]-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 62613157 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-methyl-3-[methyl(oxolan-2-ylmethyl)amino]-1-phenylpropan-1-one |
| SMILES | CC(CN(C)CC1CCCO1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H23NO2/c1-13(16(18)14-7-4-3-5-8-14)11-17(2)12-15-9-6-10-19-15/h3-5,7-8,13,15H,6,9-12H2,1-2H3 |
| InChIKey | LDFYWMPMVMMTGW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |