C13H26BrNO — CID 65015785
2-(bromomethyl)-N,3,3-trimethyl-N-(oxolan-2-ylmethyl)butan-1-amine (PubChem CID 65015785) has the molecular formula C13H26BrNO and a molecular weight of 292.26 g/mol. Its IUPAC name is 2-(bromomethyl)-N,3,3-trimethyl-N-(oxolan-2-ylmethyl)butan-1-amine.
| Compound Name | 2-(bromomethyl)-N,3,3-trimethyl-N-(oxolan-2-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 65015785 |
| Molecular Formula | C13H26BrNO |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-(bromomethyl)-N,3,3-trimethyl-N-(oxolan-2-ylmethyl)butan-1-amine |
| SMILES | CN(CC1CCCO1)CC(CBr)C(C)(C)C |
| InChI | InChI=1S/C13H26BrNO/c1-13(2,3)11(8-14)9-15(4)10-12-6-5-7-16-12/h11-12H,5-10H2,1-4H3 |
| InChIKey | ADNPMGSMBYCRFA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|