C12H26N2O — CID 102992625
N,N,N'-triethyl-N'-(oxiran-2-ylmethyl)propane-1,3-diamine (PubChem CID 102992625) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is N,N,N'-triethyl-N'-(oxiran-2-ylmethyl)propane-1,3-diamine.
| Compound Name | N,N,N'-triethyl-N'-(oxiran-2-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 102992625 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | N,N,N'-triethyl-N'-(oxiran-2-ylmethyl)propane-1,3-diamine |
| SMILES | CCN(CC)CCCN(CC)CC1CO1 |
| InChI | InChI=1S/C12H26N2O/c1-4-13(5-2)8-7-9-14(6-3)10-12-11-15-12/h12H,4-11H2,1-3H3 |
| InChIKey | DQBPPEHHXNRYMG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 19.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|