C10H21NO2 — CID 130729657
N-(1,3-dioxolan-2-ylmethyl)-N-ethylbutan-1-amine (PubChem CID 130729657) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is N-(1,3-dioxolan-2-ylmethyl)-N-ethylbutan-1-amine.
| Compound Name | N-(1,3-dioxolan-2-ylmethyl)-N-ethylbutan-1-amine |
|---|---|
| PubChem CID | 130729657 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | N-(1,3-dioxolan-2-ylmethyl)-N-ethylbutan-1-amine |
| SMILES | CCCCN(CC)CC1OCCO1 |
| InChI | InChI=1S/C10H21NO2/c1-3-5-6-11(4-2)9-10-12-7-8-13-10/h10H,3-9H2,1-2H3 |
| InChIKey | QMRLEOPUPSEJDE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |