C16H35NO2 — CID 67854629
N,N-dibutylbutan-1-amine;1,4-dioxane (PubChem CID 67854629) has the molecular formula C16H35NO2 and a molecular weight of 273.46 g/mol. Its IUPAC name is N,N-dibutylbutan-1-amine;1,4-dioxane.
| Compound Name | N,N-dibutylbutan-1-amine;1,4-dioxane |
|---|---|
| PubChem CID | 67854629 |
| Molecular Formula | C16H35NO2 |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.27 |
| IUPAC Name | N,N-dibutylbutan-1-amine;1,4-dioxane |
| SMILES | C1COCCO1.CCCCN(CCCC)CCCC |
| InChI | InChI=1S/C12H27N.C4H8O2/c1-4-7-10-13(11-8-5-2)12-9-6-3;1-2-6-4-3-5-1/h4-12H2,1-3H3;1-4H2 |
| InChIKey | WEURCJAWJZHZDU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |