C12H25NO4Si — CID 173013917
4-dimethoxysilyl-N,N-bis(oxiran-2-ylmethyl)butan-1-amine (PubChem CID 173013917) has the molecular formula C12H25NO4Si and a molecular weight of 275.42 g/mol. Its IUPAC name is 4-dimethoxysilyl-N,N-bis(oxiran-2-ylmethyl)butan-1-amine.
| Compound Name | 4-dimethoxysilyl-N,N-bis(oxiran-2-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 173013917 |
| Molecular Formula | C12H25NO4Si |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 4-dimethoxysilyl-N,N-bis(oxiran-2-ylmethyl)butan-1-amine |
| SMILES | CO[SiH](CCCCN(CC1CO1)CC1CO1)OC |
| InChI | InChI=1S/C12H25NO4Si/c1-14-18(15-2)6-4-3-5-13(7-11-9-16-11)8-12-10-17-12/h11-12,18H,3-10H2,1-2H3 |
| InChIKey | PHUUQHCDZLQELJ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 46.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|