C8H21NO2Si — CID 150995989
4-dimethoxysilyl-N,N-dimethylbutan-1-amine (PubChem CID 150995989) has the molecular formula C8H21NO2Si and a molecular weight of 191.35 g/mol. Its IUPAC name is 4-dimethoxysilyl-N,N-dimethylbutan-1-amine.
| Compound Name | 4-dimethoxysilyl-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 150995989 |
| Molecular Formula | C8H21NO2Si |
| Molecular Weight | 191.35 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-dimethoxysilyl-N,N-dimethylbutan-1-amine |
| SMILES | CO[SiH](CCCCN(C)C)OC |
| InChI | InChI=1S/C8H21NO2Si/c1-9(2)7-5-6-8-12(10-3)11-4/h12H,5-8H2,1-4H3 |
| InChIKey | LTCKAAINRJKCMU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|