About 4-dihydroxysilyl-N,N-dimethylbutan-1-amine
4-dihydroxysilyl-N,N-dimethylbutan-1-amine (PubChem CID 174146136) has the molecular formula C6H17NO2Si
and a molecular weight of 163.29 g/mol. Its IUPAC name is 4-dihydroxysilyl-N,N-dimethylbutan-1-amine.
Molecular Properties
| Compound Name | 4-dihydroxysilyl-N,N-dimethylbutan-1-amine |
| PubChem CID | 174146136 |
| Molecular Formula | C6H17NO2Si |
| Molecular Weight | 163.29 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 4-dihydroxysilyl-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCC[SiH](O)O |
| InChI | InChI=1S/C6H17NO2Si/c1-7(2)5-3-4-6-10(8)9/h8-10H,3-6H2,1-2H3 |
| InChIKey | RWUQLWNMUKQHFS-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.29 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-dihydroxysilyl-N,N-dimethylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-dihydroxysilyl-N,N-dimethylbutan-1-amine?
The IUPAC name of 4-dihydroxysilyl-N,N-dimethylbutan-1-amine (CID 174146136) is 4-dihydroxysilyl-N,N-dimethylbutan-1-amine.
What is the SMILES notation for 4-dihydroxysilyl-N,N-dimethylbutan-1-amine?
The canonical SMILES for 4-dihydroxysilyl-N,N-dimethylbutan-1-amine is CN(C)CCCC[SiH](O)O.
What is the InChIKey of 4-dihydroxysilyl-N,N-dimethylbutan-1-amine?
The InChIKey is RWUQLWNMUKQHFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H17NO2Si/c1-7(2)5-3-4-6-10(8)9/h8-10H,3-6H2,1-2H3.
What are the key properties of 4-dihydroxysilyl-N,N-dimethylbutan-1-amine?
4-dihydroxysilyl-N,N-dimethylbutan-1-amine has a molecular weight of 163.29 g/mol, XLogP of -0.47, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-dihydroxysilyl-N,N-dimethylbutan-1-amine is sourced from PubChem (CID 174146136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).