C14H33NSi — CID 154021262
N,N-dimethyl-12-silyldodecan-1-amine (PubChem CID 154021262) has the molecular formula C14H33NSi and a molecular weight of 243.51 g/mol. Its IUPAC name is N,N-dimethyl-12-silyldodecan-1-amine.
| Compound Name | N,N-dimethyl-12-silyldodecan-1-amine |
|---|---|
| PubChem CID | 154021262 |
| Molecular Formula | C14H33NSi |
| Molecular Weight | 243.51 g/mol |
| Exact Mass | 243.24 |
| IUPAC Name | N,N-dimethyl-12-silyldodecan-1-amine |
| SMILES | CN(C)CCCCCCCCCCCC[SiH3] |
| InChI | InChI=1S/C14H33NSi/c1-15(2)13-11-9-7-5-3-4-6-8-10-12-14-16/h3-14H2,1-2,16H3 |
| InChIKey | PGIURRKZUDCHSB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|