About dihydroxy(octyl)silane
dihydroxy(octyl)silane (PubChem CID 154091608) has the molecular formula C8H20O2Si
and a molecular weight of 176.33 g/mol. Its IUPAC name is dihydroxy(octyl)silane.
Molecular Properties
| Compound Name | dihydroxy(octyl)silane |
| PubChem CID | 154091608 |
| Molecular Formula | C8H20O2Si |
| Molecular Weight | 176.33 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | dihydroxy(octyl)silane |
| SMILES | CCCCCCCC[SiH](O)O |
| InChI | InChI=1S/C8H20O2Si/c1-2-3-4-5-6-7-8-11(9)10/h9-11H,2-8H2,1H3 |
| InChIKey | RDUCZWJYUCJGKQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(octyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(octyl)silane?
The IUPAC name of dihydroxy(octyl)silane (CID 154091608) is dihydroxy(octyl)silane.
What is the SMILES notation for dihydroxy(octyl)silane?
The canonical SMILES for dihydroxy(octyl)silane is CCCCCCCC[SiH](O)O.
What is the InChIKey of dihydroxy(octyl)silane?
The InChIKey is RDUCZWJYUCJGKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20O2Si/c1-2-3-4-5-6-7-8-11(9)10/h9-11H,2-8H2,1H3.
What are the key properties of dihydroxy(octyl)silane?
dihydroxy(octyl)silane has a molecular weight of 176.33 g/mol, XLogP of 1.55, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(octyl)silane is sourced from PubChem (CID 154091608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).