About hydron;trihexylsilane
hydron;trihexylsilane (PubChem CID 175247078) has the molecular formula C18H41Si+
and a molecular weight of 285.61 g/mol. Its IUPAC name is hydron;trihexylsilane.
Molecular Properties
| Compound Name | hydron;trihexylsilane |
| PubChem CID | 175247078 |
| Molecular Formula | C18H41Si+ |
| Molecular Weight | 285.61 g/mol |
| Exact Mass | 285.30 |
| IUPAC Name | hydron;trihexylsilane |
| SMILES | CCCCCC[SiH](CCCCCC)CCCCCC.[H+] |
| InChI | InChI=1S/C18H40Si/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h19H,4-18H2,1-3H3/p+1 |
| InChIKey | IBNSYFQZHBBNLR-UHFFFAOYSA-O |
| XLogP | 7.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.61 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hydron;trihexylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;trihexylsilane?
The IUPAC name of hydron;trihexylsilane (CID 175247078) is hydron;trihexylsilane.
What is the SMILES notation for hydron;trihexylsilane?
The canonical SMILES for hydron;trihexylsilane is CCCCCC[SiH](CCCCCC)CCCCCC.[H+].
What is the InChIKey of hydron;trihexylsilane?
The InChIKey is IBNSYFQZHBBNLR-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H40Si/c1-4-7-10-13-16-19(17-14-11-8-5-2)18-15-12-9-6-3/h19H,4-18H2,1-3H3/p+1.
What are the key properties of hydron;trihexylsilane?
hydron;trihexylsilane has a molecular weight of 285.61 g/mol, XLogP of 7.07, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;trihexylsilane is sourced from PubChem (CID 175247078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).