About didecyl(methyl)silane
didecyl(methyl)silane (PubChem CID 71366123) has the molecular formula C21H46Si
and a molecular weight of 326.69 g/mol. Its IUPAC name is didecyl(methyl)silane.
Molecular Properties
| Compound Name | didecyl(methyl)silane |
| PubChem CID | 71366123 |
| Molecular Formula | C21H46Si |
| Molecular Weight | 326.69 g/mol |
| Exact Mass | 326.34 |
| IUPAC Name | didecyl(methyl)silane |
| SMILES | CCCCCCCCCC[SiH](C)CCCCCCCCCC |
| InChI | InChI=1S/C21H46Si/c1-4-6-8-10-12-14-16-18-20-22(3)21-19-17-15-13-11-9-7-5-2/h22H,4-21H2,1-3H3 |
| InChIKey | GVVXXRLVHMVELK-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.69 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze didecyl(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of didecyl(methyl)silane?
The IUPAC name of didecyl(methyl)silane (CID 71366123) is didecyl(methyl)silane.
What is the SMILES notation for didecyl(methyl)silane?
The canonical SMILES for didecyl(methyl)silane is CCCCCCCCCC[SiH](C)CCCCCCCCCC.
What is the InChIKey of didecyl(methyl)silane?
The InChIKey is GVVXXRLVHMVELK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H46Si/c1-4-6-8-10-12-14-16-18-20-22(3)21-19-17-15-13-11-9-7-5-2/h22H,4-21H2,1-3H3.
What are the key properties of didecyl(methyl)silane?
didecyl(methyl)silane has a molecular weight of 326.69 g/mol, XLogP of 8.12, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for didecyl(methyl)silane is sourced from PubChem (CID 71366123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).