About butyl-di(nonyl)silane
butyl-di(nonyl)silane (PubChem CID 174773592) has the molecular formula C22H48Si
and a molecular weight of 340.71 g/mol. Its IUPAC name is butyl-di(nonyl)silane.
Molecular Properties
| Compound Name | butyl-di(nonyl)silane |
| PubChem CID | 174773592 |
| Molecular Formula | C22H48Si |
| Molecular Weight | 340.71 g/mol |
| Exact Mass | 340.35 |
| IUPAC Name | butyl-di(nonyl)silane |
| SMILES | CCCCCCCCC[SiH](CCCC)CCCCCCCCC |
| InChI | InChI=1S/C22H48Si/c1-4-7-10-12-14-16-18-21-23(20-9-6-3)22-19-17-15-13-11-8-5-2/h23H,4-22H2,1-3H3 |
| InChIKey | JRFNEHBFIDPRPU-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.71 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butyl-di(nonyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-di(nonyl)silane?
The IUPAC name of butyl-di(nonyl)silane (CID 174773592) is butyl-di(nonyl)silane.
What is the SMILES notation for butyl-di(nonyl)silane?
The canonical SMILES for butyl-di(nonyl)silane is CCCCCCCCC[SiH](CCCC)CCCCCCCCC.
What is the InChIKey of butyl-di(nonyl)silane?
The InChIKey is JRFNEHBFIDPRPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H48Si/c1-4-7-10-12-14-16-18-21-23(20-9-6-3)22-19-17-15-13-11-8-5-2/h23H,4-22H2,1-3H3.
What are the key properties of butyl-di(nonyl)silane?
butyl-di(nonyl)silane has a molecular weight of 340.71 g/mol, XLogP of 8.51, 19 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-di(nonyl)silane is sourced from PubChem (CID 174773592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).