C24H56N2O8Si2 — CID 165406159
2-[2-[2-hydroxyethyl(3-triethoxysilylpropyl)amino]ethyl-(3-triethoxysilylpropyl)amino]ethanol (PubChem CID 165406159) has the molecular formula C24H56N2O8Si2 and a molecular weight of 556.89 g/mol. Its IUPAC name is 2-[2-[2-hydroxyethyl(3-triethoxysilylpropyl)amino]ethyl-(3-triethoxysilylpropyl)amino]ethanol.
| Compound Name | 2-[2-[2-hydroxyethyl(3-triethoxysilylpropyl)amino]ethyl-(3-triethoxysilylpropyl)amino]ethanol |
|---|---|
| PubChem CID | 165406159 |
| Molecular Formula | C24H56N2O8Si2 |
| Molecular Weight | 556.89 g/mol |
| Exact Mass | 556.36 |
| IUPAC Name | 2-[2-[2-hydroxyethyl(3-triethoxysilylpropyl)amino]ethyl-(3-triethoxysilylpropyl)amino]ethanol |
| SMILES | CCO[Si](CCCN(CCO)CCN(CCO)CCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C24H56N2O8Si2/c1-7-29-35(30-8-2,31-9-3)23-13-15-25(19-21-27)17-18-26(20-22-28)16-14-24-36(32-10-4,33-11-5)34-12-6/h27-28H,7-24H2,1-6H3 |
| InChIKey | LFEVDWFQWKKLHM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.89 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|