C29H63N3O10Si2 — CID 58720478
N-[3-[bis(2-hydroxyethyl)amino]propyl]-N'-methyl-2,2-bis(3-triethoxysilylpropyl)propanediamide (PubChem CID 58720478) has the molecular formula C29H63N3O10Si2 and a molecular weight of 670.01 g/mol. Its IUPAC name is N-[3-[bis(2-hydroxyethyl)amino]propyl]-N'-methyl-2,2-bis(3-triethoxysilylpropyl)propanediamide.
| Compound Name | N-[3-[bis(2-hydroxyethyl)amino]propyl]-N'-methyl-2,2-bis(3-triethoxysilylpropyl)propanediamide |
|---|---|
| PubChem CID | 58720478 |
| Molecular Formula | C29H63N3O10Si2 |
| Molecular Weight | 670.01 g/mol |
| Exact Mass | 669.41 |
| IUPAC Name | N-[3-[bis(2-hydroxyethyl)amino]propyl]-N'-methyl-2,2-bis(3-triethoxysilylpropyl)propanediamide |
| SMILES | CCO[Si](CCCC(CCC[Si](OCC)(OCC)OCC)(C(=O)NC)C(=O)NCCCN(CCO)CCO)(OCC)OCC |
| InChI | InChI=1S/C29H63N3O10Si2/c1-8-37-43(38-9-2,39-10-3)25-14-17-29(27(35)30-7,18-15-26-44(40-11-4,41-12-5)42-13-6)28(36)31-19-16-20-32(21-23-33)22-24-34/h33-34H,8-26H2,1-7H3,(H,30,35)(H,31,36) |
| InChIKey | GSAPYPACCZRFRS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 157.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.01 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|