C16H36N2O4Si — CID 59782779
1,1-dipropyl-3-(3-triethoxysilylpropyl)urea (PubChem CID 59782779) has the molecular formula C16H36N2O4Si and a molecular weight of 348.56 g/mol. Its IUPAC name is 1,1-dipropyl-3-(3-triethoxysilylpropyl)urea.
| Compound Name | 1,1-dipropyl-3-(3-triethoxysilylpropyl)urea |
|---|---|
| PubChem CID | 59782779 |
| Molecular Formula | C16H36N2O4Si |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | 1,1-dipropyl-3-(3-triethoxysilylpropyl)urea |
| SMILES | CCCN(CCC)C(=O)NCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C16H36N2O4Si/c1-6-13-18(14-7-2)16(19)17-12-11-15-23(20-8-3,21-9-4)22-10-5/h6-15H2,1-5H3,(H,17,19) |
| InChIKey | CJNFPHVWZKGYDV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|