C18H43N4O5PSi — CID 160690562
1-[2-(methylamino)ethyl]-1-[2-(phosphanylamino)ethyl]-3-(3-triethoxysilylpropyl)urea;propan-2-one (PubChem CID 160690562) has the molecular formula C18H43N4O5PSi and a molecular weight of 454.63 g/mol. Its IUPAC name is 1-[2-(methylamino)ethyl]-1-[2-(phosphanylamino)ethyl]-3-(3-triethoxysilylpropyl)urea;propan-2-one.
| Compound Name | 1-[2-(methylamino)ethyl]-1-[2-(phosphanylamino)ethyl]-3-(3-triethoxysilylpropyl)urea;propan-2-one |
|---|---|
| PubChem CID | 160690562 |
| Molecular Formula | C18H43N4O5PSi |
| Molecular Weight | 454.63 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 1-[2-(methylamino)ethyl]-1-[2-(phosphanylamino)ethyl]-3-(3-triethoxysilylpropyl)urea;propan-2-one |
| SMILES | CC(C)=O.CCO[Si](CCCNC(=O)N(CCNC)CCNP)(OCC)OCC |
| InChI | InChI=1S/C15H37N4O4PSi.C3H6O/c1-5-21-25(22-6-2,23-7-3)14-8-9-17-15(20)19(12-10-16-4)13-11-18-24;1-3(2)4/h16,18H,5-14,24H2,1-4H3,(H,17,20);1-2H3 |
| InChIKey | RPISHXKTMBFOGX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.63 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|