C17H42N5O4PSi — CID 22964415
1-[1-[2-[2-(methylamino)ethyl-phosphanylamino]ethylamino]ethyl]-3-(3-triethoxysilylpropyl)urea (PubChem CID 22964415) has the molecular formula C17H42N5O4PSi and a molecular weight of 439.61 g/mol. Its IUPAC name is 1-[1-[2-[2-(methylamino)ethyl-phosphanylamino]ethylamino]ethyl]-3-(3-triethoxysilylpropyl)urea.
| Compound Name | 1-[1-[2-[2-(methylamino)ethyl-phosphanylamino]ethylamino]ethyl]-3-(3-triethoxysilylpropyl)urea |
|---|---|
| PubChem CID | 22964415 |
| Molecular Formula | C17H42N5O4PSi |
| Molecular Weight | 439.61 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 1-[1-[2-[2-(methylamino)ethyl-phosphanylamino]ethylamino]ethyl]-3-(3-triethoxysilylpropyl)urea |
| SMILES | CCO[Si](CCCNC(=O)NC(C)NCCN(P)CCNC)(OCC)OCC |
| InChI | InChI=1S/C17H42N5O4PSi/c1-6-24-28(25-7-2,26-8-3)15-9-10-20-17(23)21-16(4)19-12-14-22(27)13-11-18-5/h16,18-19H,6-15,27H2,1-5H3,(H2,20,21,23) |
| InChIKey | HAIOAWXKHZKCNI-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 96.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.61 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|