C21H48N6O8SSi2 — CID 102174342
1-(3-triethoxysilylpropyl)-3-[(3-triethoxysilylpropylcarbamoylamino)carbamothioylamino]urea (PubChem CID 102174342) has the molecular formula C21H48N6O8SSi2 and a molecular weight of 600.89 g/mol. Its IUPAC name is 1-(3-triethoxysilylpropyl)-3-[(3-triethoxysilylpropylcarbamoylamino)carbamothioylamino]urea.
| Compound Name | 1-(3-triethoxysilylpropyl)-3-[(3-triethoxysilylpropylcarbamoylamino)carbamothioylamino]urea |
|---|---|
| PubChem CID | 102174342 |
| Molecular Formula | C21H48N6O8SSi2 |
| Molecular Weight | 600.89 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | 1-(3-triethoxysilylpropyl)-3-[(3-triethoxysilylpropylcarbamoylamino)carbamothioylamino]urea |
| SMILES | CCO[Si](CCCNC(=O)NNC(=S)NNC(=O)NCCC[Si](OCC)(OCC)OCC)(OCC)OCC |
| InChI | InChI=1S/C21H48N6O8SSi2/c1-7-30-37(31-8-2,32-9-3)17-13-15-22-19(28)24-26-21(36)27-25-20(29)23-16-14-18-38(33-10-4,34-11-5)35-12-6/h7-18H2,1-6H3,(H2,22,24,28)(H2,23,25,29)(H2,26,27,36) |
| InChIKey | PSDFQZCHLDGGIS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 161.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.89 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|