C19H43N3O8Si2 — CID 10289103
2-[methyl(3-triethoxysilylpropylcarbamoyl)amino]-N-(3-trimethoxysilylpropyl)acetamide (PubChem CID 10289103) has the molecular formula C19H43N3O8Si2 and a molecular weight of 497.74 g/mol. Its IUPAC name is 2-[methyl(3-triethoxysilylpropylcarbamoyl)amino]-N-(3-trimethoxysilylpropyl)acetamide.
| Compound Name | 2-[methyl(3-triethoxysilylpropylcarbamoyl)amino]-N-(3-trimethoxysilylpropyl)acetamide |
|---|---|
| PubChem CID | 10289103 |
| Molecular Formula | C19H43N3O8Si2 |
| Molecular Weight | 497.74 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 2-[methyl(3-triethoxysilylpropylcarbamoyl)amino]-N-(3-trimethoxysilylpropyl)acetamide |
| SMILES | CCO[Si](CCCNC(=O)N(C)CC(=O)NCCC[Si](OC)(OC)OC)(OCC)OCC |
| InChI | InChI=1S/C19H43N3O8Si2/c1-8-28-32(29-9-2,30-10-3)16-12-14-21-19(24)22(4)17-18(23)20-13-11-15-31(25-5,26-6)27-7/h8-17H2,1-7H3,(H,20,23)(H,21,24) |
| InChIKey | ZQWINAMSTQNAGO-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.74 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|