C18H32N2O4Si — CID 91387423
1-ethyl-1-phenyl-3-(3-triethoxysilylpropyl)urea (PubChem CID 91387423) has the molecular formula C18H32N2O4Si and a molecular weight of 368.55 g/mol. Its IUPAC name is 1-ethyl-1-phenyl-3-(3-triethoxysilylpropyl)urea.
| Compound Name | 1-ethyl-1-phenyl-3-(3-triethoxysilylpropyl)urea |
|---|---|
| PubChem CID | 91387423 |
| Molecular Formula | C18H32N2O4Si |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1-ethyl-1-phenyl-3-(3-triethoxysilylpropyl)urea |
| SMILES | CCO[Si](CCCNC(=O)N(CC)c1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C18H32N2O4Si/c1-5-20(17-13-10-9-11-14-17)18(21)19-15-12-16-25(22-6-2,23-7-3)24-8-4/h9-11,13-14H,5-8,12,15-16H2,1-4H3,(H,19,21) |
| InChIKey | ZFPXLZSDMCEEMG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|