C28H54N4O8Si2 — CID 91406326
1-[carbamoyl(3-triethoxysilylpropyl)amino]-1-(2-phenylethyl)-3-(3-triethoxysilylpropyl)urea (PubChem CID 91406326) has the molecular formula C28H54N4O8Si2 and a molecular weight of 630.93 g/mol. Its IUPAC name is 1-[carbamoyl(3-triethoxysilylpropyl)amino]-1-(2-phenylethyl)-3-(3-triethoxysilylpropyl)urea.
| Compound Name | 1-[carbamoyl(3-triethoxysilylpropyl)amino]-1-(2-phenylethyl)-3-(3-triethoxysilylpropyl)urea |
|---|---|
| PubChem CID | 91406326 |
| Molecular Formula | C28H54N4O8Si2 |
| Molecular Weight | 630.93 g/mol |
| Exact Mass | 630.35 |
| IUPAC Name | 1-[carbamoyl(3-triethoxysilylpropyl)amino]-1-(2-phenylethyl)-3-(3-triethoxysilylpropyl)urea |
| SMILES | CCO[Si](CCCNC(=O)N(CCc1ccccc1)N(CCC[Si](OCC)(OCC)OCC)C(N)=O)(OCC)OCC |
| InChI | InChI=1S/C28H54N4O8Si2/c1-7-35-41(36-8-2,37-9-3)24-16-21-30-28(34)32(23-20-26-18-14-13-15-19-26)31(27(29)33)22-17-25-42(38-10-4,39-11-5)40-12-6/h13-15,18-19H,7-12,16-17,20-25H2,1-6H3,(H2,29,33)(H,30,34) |
| InChIKey | AULILVFDKGAEIU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 134.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.93 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|