C26H52N2O12Si2 — CID 174032180
2,3-bis[2-oxo-2-(3-triethoxysilylpropylamino)ethyl]butanedioic acid (PubChem CID 174032180) has the molecular formula C26H52N2O12Si2 and a molecular weight of 640.88 g/mol. Its IUPAC name is 2,3-bis[2-oxo-2-(3-triethoxysilylpropylamino)ethyl]butanedioic acid.
| Compound Name | 2,3-bis[2-oxo-2-(3-triethoxysilylpropylamino)ethyl]butanedioic acid |
|---|---|
| PubChem CID | 174032180 |
| Molecular Formula | C26H52N2O12Si2 |
| Molecular Weight | 640.88 g/mol |
| Exact Mass | 640.31 |
| IUPAC Name | 2,3-bis[2-oxo-2-(3-triethoxysilylpropylamino)ethyl]butanedioic acid |
| SMILES | CCO[Si](CCCNC(=O)CC(C(=O)O)C(CC(=O)NCCC[Si](OCC)(OCC)OCC)C(=O)O)(OCC)OCC |
| InChI | InChI=1S/C26H52N2O12Si2/c1-7-35-41(36-8-2,37-9-3)17-13-15-27-23(29)19-21(25(31)32)22(26(33)34)20-24(30)28-16-14-18-42(38-10-4,39-11-5)40-12-6/h21-22H,7-20H2,1-6H3,(H,27,29)(H,28,30)(H,31,32)(H,33,34) |
| InChIKey | FWBVIUKRJXKJPT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 188.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.88 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|