C15H32N2O5SSi — CID 58903348
2-methylsulfanyl-N-[2-oxo-2-(3-triethoxysilylpropylamino)ethyl]propanamide (PubChem CID 58903348) has the molecular formula C15H32N2O5SSi and a molecular weight of 380.58 g/mol. Its IUPAC name is 2-methylsulfanyl-N-[2-oxo-2-(3-triethoxysilylpropylamino)ethyl]propanamide.
| Compound Name | 2-methylsulfanyl-N-[2-oxo-2-(3-triethoxysilylpropylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 58903348 |
| Molecular Formula | C15H32N2O5SSi |
| Molecular Weight | 380.58 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 2-methylsulfanyl-N-[2-oxo-2-(3-triethoxysilylpropylamino)ethyl]propanamide |
| SMILES | CCO[Si](CCCNC(=O)CNC(=O)C(C)SC)(OCC)OCC |
| InChI | InChI=1S/C15H32N2O5SSi/c1-6-20-24(21-7-2,22-8-3)11-9-10-16-14(18)12-17-15(19)13(4)23-5/h13H,6-12H2,1-5H3,(H,16,18)(H,17,19) |
| InChIKey | CVMPZUUGSMDUFP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.58 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|