C26H59N3O3Si — CID 140647743
N'-[3-(dipropylamino)propyl]-N,N-dipropyl-N'-(2-triethoxysilylethyl)propane-1,3-diamine (PubChem CID 140647743) has the molecular formula C26H59N3O3Si and a molecular weight of 489.86 g/mol. Its IUPAC name is N'-[3-(dipropylamino)propyl]-N,N-dipropyl-N'-(2-triethoxysilylethyl)propane-1,3-diamine.
| Compound Name | N'-[3-(dipropylamino)propyl]-N,N-dipropyl-N'-(2-triethoxysilylethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 140647743 |
| Molecular Formula | C26H59N3O3Si |
| Molecular Weight | 489.86 g/mol |
| Exact Mass | 489.43 |
| IUPAC Name | N'-[3-(dipropylamino)propyl]-N,N-dipropyl-N'-(2-triethoxysilylethyl)propane-1,3-diamine |
| SMILES | CCCN(CCC)CCCN(CCCN(CCC)CCC)CC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C26H59N3O3Si/c1-8-17-27(18-9-2)21-15-23-29(24-16-22-28(19-10-3)20-11-4)25-26-33(30-12-5,31-13-6)32-14-7/h8-26H2,1-7H3 |
| InChIKey | LXSDEGFLXQYWSD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.86 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|