C33H73N3O3Si — CID 142718234
3-[2-(dipropylamino)ethyl]-N,N,N',N'-tetrapropyl-3-(2-triethoxysilylethyl)pentane-1,5-diamine (PubChem CID 142718234) has the molecular formula C33H73N3O3Si and a molecular weight of 588.05 g/mol. Its IUPAC name is 3-[2-(dipropylamino)ethyl]-N,N,N',N'-tetrapropyl-3-(2-triethoxysilylethyl)pentane-1,5-diamine.
| Compound Name | 3-[2-(dipropylamino)ethyl]-N,N,N',N'-tetrapropyl-3-(2-triethoxysilylethyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 142718234 |
| Molecular Formula | C33H73N3O3Si |
| Molecular Weight | 588.05 g/mol |
| Exact Mass | 587.54 |
| IUPAC Name | 3-[2-(dipropylamino)ethyl]-N,N,N',N'-tetrapropyl-3-(2-triethoxysilylethyl)pentane-1,5-diamine |
| SMILES | CCCN(CCC)CCC(CCN(CCC)CCC)(CCN(CCC)CCC)CC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C33H73N3O3Si/c1-10-23-34(24-11-2)29-19-33(20-30-35(25-12-3)26-13-4,21-31-36(27-14-5)28-15-6)22-32-40(37-16-7,38-17-8)39-18-9/h10-32H2,1-9H3 |
| InChIKey | LKNZOADJXYSOMS-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.05 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|