C13H31NOSi — CID 87204397
3-[ethoxy(dimethyl)silyl]-N,N-dipropylpropan-1-amine (PubChem CID 87204397) has the molecular formula C13H31NOSi and a molecular weight of 245.48 g/mol. Its IUPAC name is 3-[ethoxy(dimethyl)silyl]-N,N-dipropylpropan-1-amine.
| Compound Name | 3-[ethoxy(dimethyl)silyl]-N,N-dipropylpropan-1-amine |
|---|---|
| PubChem CID | 87204397 |
| Molecular Formula | C13H31NOSi |
| Molecular Weight | 245.48 g/mol |
| Exact Mass | 245.22 |
| IUPAC Name | 3-[ethoxy(dimethyl)silyl]-N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CCC[Si](C)(C)OCC |
| InChI | InChI=1S/C13H31NOSi/c1-6-10-14(11-7-2)12-9-13-16(4,5)15-8-3/h6-13H2,1-5H3 |
| InChIKey | URWZAYNFHNPVLO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|