C12H33NOSi3 — CID 87431017
2-[ethoxy(dimethyl)silyl]-N,N-bis(trimethylsilyl)ethanamine (PubChem CID 87431017) has the molecular formula C12H33NOSi3 and a molecular weight of 291.66 g/mol. Its IUPAC name is 2-[ethoxy(dimethyl)silyl]-N,N-bis(trimethylsilyl)ethanamine.
| Compound Name | 2-[ethoxy(dimethyl)silyl]-N,N-bis(trimethylsilyl)ethanamine |
|---|---|
| PubChem CID | 87431017 |
| Molecular Formula | C12H33NOSi3 |
| Molecular Weight | 291.66 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2-[ethoxy(dimethyl)silyl]-N,N-bis(trimethylsilyl)ethanamine |
| SMILES | CCO[Si](C)(C)CCN([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C12H33NOSi3/c1-10-14-17(8,9)12-11-13(15(2,3)4)16(5,6)7/h10-12H2,1-9H3 |
| InChIKey | HFJJBKWBMFSLSG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.66 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|