C16H41NO2Si3 — CID 149160399
N-[tert-butyl(dimethyl)silyl]-2-[diethoxy(methyl)silyl]-N-trimethylsilylethanamine (PubChem CID 149160399) has the molecular formula C16H41NO2Si3 and a molecular weight of 363.77 g/mol. Its IUPAC name is N-[tert-butyl(dimethyl)silyl]-2-[diethoxy(methyl)silyl]-N-trimethylsilylethanamine.
| Compound Name | N-[tert-butyl(dimethyl)silyl]-2-[diethoxy(methyl)silyl]-N-trimethylsilylethanamine |
|---|---|
| PubChem CID | 149160399 |
| Molecular Formula | C16H41NO2Si3 |
| Molecular Weight | 363.77 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | N-[tert-butyl(dimethyl)silyl]-2-[diethoxy(methyl)silyl]-N-trimethylsilylethanamine |
| SMILES | CCO[Si](C)(CCN([Si](C)(C)C)[Si](C)(C)C(C)(C)C)OCC |
| InChI | InChI=1S/C16H41NO2Si3/c1-12-18-22(11,19-13-2)15-14-17(20(6,7)8)21(9,10)16(3,4)5/h12-15H2,1-11H3 |
| InChIKey | VAARTVJKOLGWHW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.77 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|