C10H26O2SSi2 — CID 88867782
diethoxy-methyl-(2-trimethylsilylsulfanylethyl)silane (PubChem CID 88867782) has the molecular formula C10H26O2SSi2 and a molecular weight of 266.55 g/mol. Its IUPAC name is diethoxy-methyl-(2-trimethylsilylsulfanylethyl)silane.
| Compound Name | diethoxy-methyl-(2-trimethylsilylsulfanylethyl)silane |
|---|---|
| PubChem CID | 88867782 |
| Molecular Formula | C10H26O2SSi2 |
| Molecular Weight | 266.55 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | diethoxy-methyl-(2-trimethylsilylsulfanylethyl)silane |
| SMILES | CCO[Si](C)(CCS[Si](C)(C)C)OCC |
| InChI | InChI=1S/C10H26O2SSi2/c1-7-11-15(6,12-8-2)10-9-13-14(3,4)5/h7-10H2,1-6H3 |
| InChIKey | IYVYXODKEOGBRX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|