C19H48O6SSi3 — CID 165005930
[diethoxy(methyl)silyl]methanethiol;3-[diethoxy(methyl)silyl]propyl-diethoxy-methylsilane (PubChem CID 165005930) has the molecular formula C19H48O6SSi3 and a molecular weight of 488.91 g/mol. Its IUPAC name is [diethoxy(methyl)silyl]methanethiol;3-[diethoxy(methyl)silyl]propyl-diethoxy-methylsilane.
| Compound Name | [diethoxy(methyl)silyl]methanethiol;3-[diethoxy(methyl)silyl]propyl-diethoxy-methylsilane |
|---|---|
| PubChem CID | 165005930 |
| Molecular Formula | C19H48O6SSi3 |
| Molecular Weight | 488.91 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | [diethoxy(methyl)silyl]methanethiol;3-[diethoxy(methyl)silyl]propyl-diethoxy-methylsilane |
| SMILES | CCO[Si](C)(CCC[Si](C)(OCC)OCC)OCC.CCO[Si](C)(CS)OCC |
| InChI | InChI=1S/C13H32O4Si2.C6H16O2SSi/c1-7-14-18(5,15-8-2)12-11-13-19(6,16-9-3)17-10-4;1-4-7-10(3,6-9)8-5-2/h7-13H2,1-6H3;9H,4-6H2,1-3H3 |
| InChIKey | IYQCBASMFCMDTB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.91 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|