C13H32O3Si2 — CID 58151778
diethoxy-[3-(ethoxy-ethyl-methylsilyl)propyl]-methylsilane (PubChem CID 58151778) has the molecular formula C13H32O3Si2 and a molecular weight of 292.57 g/mol. Its IUPAC name is diethoxy-[3-(ethoxy-ethyl-methylsilyl)propyl]-methylsilane.
| Compound Name | diethoxy-[3-(ethoxy-ethyl-methylsilyl)propyl]-methylsilane |
|---|---|
| PubChem CID | 58151778 |
| Molecular Formula | C13H32O3Si2 |
| Molecular Weight | 292.57 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | diethoxy-[3-(ethoxy-ethyl-methylsilyl)propyl]-methylsilane |
| SMILES | CCO[Si](C)(CC)CCC[Si](C)(OCC)OCC |
| InChI | InChI=1S/C13H32O3Si2/c1-7-14-17(5,10-4)12-11-13-18(6,15-8-2)16-9-3/h7-13H2,1-6H3 |
| InChIKey | FBKKYTVKPQYGAL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|