C11H19F7O3Si — CID 154132639
diethoxy-[3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)propyl]-methylsilane (PubChem CID 154132639) has the molecular formula C11H19F7O3Si and a molecular weight of 360.34 g/mol. Its IUPAC name is diethoxy-[3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)propyl]-methylsilane.
| Compound Name | diethoxy-[3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)propyl]-methylsilane |
|---|---|
| PubChem CID | 154132639 |
| Molecular Formula | C11H19F7O3Si |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | diethoxy-[3-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)propyl]-methylsilane |
| SMILES | CCO[Si](C)(CCCOC(F)(C(F)(F)F)C(F)(F)F)OCC |
| InChI | InChI=1S/C11H19F7O3Si/c1-4-20-22(3,21-5-2)8-6-7-19-9(12,10(13,14)15)11(16,17)18/h4-8H2,1-3H3 |
| InChIKey | YDWYTADQCJGRKW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|