C27H61N3O3Si — CID 140647245
4-[3-(diethylamino)propyl]-N,N,N',N'-tetraethyl-4-(2-trimethoxysilylethyl)heptane-1,7-diamine (PubChem CID 140647245) has the molecular formula C27H61N3O3Si and a molecular weight of 503.89 g/mol. Its IUPAC name is 4-[3-(diethylamino)propyl]-N,N,N',N'-tetraethyl-4-(2-trimethoxysilylethyl)heptane-1,7-diamine.
| Compound Name | 4-[3-(diethylamino)propyl]-N,N,N',N'-tetraethyl-4-(2-trimethoxysilylethyl)heptane-1,7-diamine |
|---|---|
| PubChem CID | 140647245 |
| Molecular Formula | C27H61N3O3Si |
| Molecular Weight | 503.89 g/mol |
| Exact Mass | 503.45 |
| IUPAC Name | 4-[3-(diethylamino)propyl]-N,N,N',N'-tetraethyl-4-(2-trimethoxysilylethyl)heptane-1,7-diamine |
| SMILES | CCN(CC)CCCC(CCCN(CC)CC)(CCCN(CC)CC)CC[Si](OC)(OC)OC |
| InChI | InChI=1S/C27H61N3O3Si/c1-10-28(11-2)23-16-19-27(20-17-24-29(12-3)13-4,21-18-25-30(14-5)15-6)22-26-34(31-7,32-8)33-9/h10-26H2,1-9H3 |
| InChIKey | MIMDBYONTRGYFH-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.89 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|