C11H27NO4Si — CID 90074439
N,N-diethyl-2-(2-trimethoxysilylethoxy)ethanamine (PubChem CID 90074439) has the molecular formula C11H27NO4Si and a molecular weight of 265.43 g/mol. Its IUPAC name is N,N-diethyl-2-(2-trimethoxysilylethoxy)ethanamine.
| Compound Name | N,N-diethyl-2-(2-trimethoxysilylethoxy)ethanamine |
|---|---|
| PubChem CID | 90074439 |
| Molecular Formula | C11H27NO4Si |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | N,N-diethyl-2-(2-trimethoxysilylethoxy)ethanamine |
| SMILES | CCN(CC)CCOCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C11H27NO4Si/c1-6-12(7-2)8-9-16-10-11-17(13-3,14-4)15-5/h6-11H2,1-5H3 |
| InChIKey | LYHSKIYVXVWWDF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|