C13H32N2O3Si — CID 163209900
N',N'-diethyl-N-methyl-N-(3-trimethoxysilylpropyl)ethane-1,2-diamine (PubChem CID 163209900) has the molecular formula C13H32N2O3Si and a molecular weight of 292.50 g/mol. Its IUPAC name is N',N'-diethyl-N-methyl-N-(3-trimethoxysilylpropyl)ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-methyl-N-(3-trimethoxysilylpropyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 163209900 |
| Molecular Formula | C13H32N2O3Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | N',N'-diethyl-N-methyl-N-(3-trimethoxysilylpropyl)ethane-1,2-diamine |
| SMILES | CCN(CC)CCN(C)CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C13H32N2O3Si/c1-7-15(8-2)12-11-14(3)10-9-13-19(16-4,17-5)18-6/h7-13H2,1-6H3 |
| InChIKey | DWQSYDISVNPDQR-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|