C11H28N2O7S2Si — CID 139973982
N-methylsulfonyl-N-[2-[methyl(3-trimethoxysilylpropyl)amino]ethyl]methanesulfonamide (PubChem CID 139973982) has the molecular formula C11H28N2O7S2Si and a molecular weight of 392.57 g/mol. Its IUPAC name is N-methylsulfonyl-N-[2-[methyl(3-trimethoxysilylpropyl)amino]ethyl]methanesulfonamide.
| Compound Name | N-methylsulfonyl-N-[2-[methyl(3-trimethoxysilylpropyl)amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 139973982 |
| Molecular Formula | C11H28N2O7S2Si |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-methylsulfonyl-N-[2-[methyl(3-trimethoxysilylpropyl)amino]ethyl]methanesulfonamide |
| SMILES | CO[Si](CCCN(C)CCN(S(C)(=O)=O)S(C)(=O)=O)(OC)OC |
| InChI | InChI=1S/C11H28N2O7S2Si/c1-12(8-7-11-23(18-2,19-3)20-4)9-10-13(21(5,14)15)22(6,16)17/h7-11H2,1-6H3 |
| InChIKey | COHXLTCVMCUHCU-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|