C14H34N2O7S2Si — CID 139973974
N-[2,3-dimethyl-3-[methylsulfonyl(3-trimethoxysilylpropyl)amino]butan-2-yl]methanesulfonamide (PubChem CID 139973974) has the molecular formula C14H34N2O7S2Si and a molecular weight of 434.65 g/mol. Its IUPAC name is N-[2,3-dimethyl-3-[methylsulfonyl(3-trimethoxysilylpropyl)amino]butan-2-yl]methanesulfonamide.
| Compound Name | N-[2,3-dimethyl-3-[methylsulfonyl(3-trimethoxysilylpropyl)amino]butan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 139973974 |
| Molecular Formula | C14H34N2O7S2Si |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-[2,3-dimethyl-3-[methylsulfonyl(3-trimethoxysilylpropyl)amino]butan-2-yl]methanesulfonamide |
| SMILES | CO[Si](CCCN(C(C)(C)C(C)(C)NS(C)(=O)=O)S(C)(=O)=O)(OC)OC |
| InChI | InChI=1S/C14H34N2O7S2Si/c1-13(2,15-24(8,17)18)14(3,4)16(25(9,19)20)11-10-12-26(21-5,22-6)23-7/h15H,10-12H2,1-9H3 |
| InChIKey | IJNUEQYCYDFIJU-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|