C10H25NO6SSi — CID 46830547
3-[methyl(3-trimethoxysilylpropyl)amino]propane-1-sulfonic acid (PubChem CID 46830547) has the molecular formula C10H25NO6SSi and a molecular weight of 315.46 g/mol. Its IUPAC name is 3-[methyl(3-trimethoxysilylpropyl)amino]propane-1-sulfonic acid.
| Compound Name | 3-[methyl(3-trimethoxysilylpropyl)amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 46830547 |
| Molecular Formula | C10H25NO6SSi |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 3-[methyl(3-trimethoxysilylpropyl)amino]propane-1-sulfonic acid |
| SMILES | CO[Si](CCCN(C)CCCS(=O)(=O)O)(OC)OC |
| InChI | InChI=1S/C10H25NO6SSi/c1-11(7-5-9-18(12,13)14)8-6-10-19(15-2,16-3)17-4/h5-10H2,1-4H3,(H,12,13,14) |
| InChIKey | PFAREDCBFWUTIJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|