C17H41NO7Si2 — CID 162116460
N-(2-propoxyethyl)-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propan-1-amine (PubChem CID 162116460) has the molecular formula C17H41NO7Si2 and a molecular weight of 427.69 g/mol. Its IUPAC name is N-(2-propoxyethyl)-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propan-1-amine.
| Compound Name | N-(2-propoxyethyl)-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propan-1-amine |
|---|---|
| PubChem CID | 162116460 |
| Molecular Formula | C17H41NO7Si2 |
| Molecular Weight | 427.69 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | N-(2-propoxyethyl)-3-trimethoxysilyl-N-(3-trimethoxysilylpropyl)propan-1-amine |
| SMILES | CCCOCCN(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C17H41NO7Si2/c1-8-14-25-15-13-18(11-9-16-26(19-2,20-3)21-4)12-10-17-27(22-5,23-6)24-7/h8-17H2,1-7H3 |
| InChIKey | XOCNEPJIFFDTAD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 67.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.69 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|