C12H27NO5Si — CID 151472451
3-[propyl(3-trimethoxysilylpropyl)amino]propanoic acid (PubChem CID 151472451) has the molecular formula C12H27NO5Si and a molecular weight of 293.44 g/mol. Its IUPAC name is 3-[propyl(3-trimethoxysilylpropyl)amino]propanoic acid.
| Compound Name | 3-[propyl(3-trimethoxysilylpropyl)amino]propanoic acid |
|---|---|
| PubChem CID | 151472451 |
| Molecular Formula | C12H27NO5Si |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 3-[propyl(3-trimethoxysilylpropyl)amino]propanoic acid |
| SMILES | CCCN(CCC[Si](OC)(OC)OC)CCC(=O)O |
| InChI | InChI=1S/C12H27NO5Si/c1-5-8-13(10-7-12(14)15)9-6-11-19(16-2,17-3)18-4/h5-11H2,1-4H3,(H,14,15) |
| InChIKey | PKTLLIQGNZSCDD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|