3-[hexyl(3-trimethoxysilylpropyl)amino]propanoic acid

C15H33NO5Si — CID 150372013

IUPAC3-[hexyl(3-trimethoxysilylpropyl)amino]propanoic acid
SMILESCCCCCCN(CCC[Si](OC)(OC)OC)CCC(=O)O
InChIInChI=1S/C15H33NO5Si/c1-5-6-7-8-11-16(13-10-15(17)18)12-9-14-22(19-2,20-3)21-4/h5-14H2,1-4H3,(H,17,18)
InChIKeyGXXSZCZQDAUKLO-UHFFFAOYSA-N
MW335.52 g/mol
LogP2.61
Rot. Bonds15

About 3-[hexyl(3-trimethoxysilylpropyl)amino]propanoic acid

3-[hexyl(3-trimethoxysilylpropyl)amino]propanoic acid (PubChem CID 150372013) has the molecular formula C15H33NO5Si and a molecular weight of 335.52 g/mol. Its IUPAC name is 3-[hexyl(3-trimethoxysilylpropyl)amino]propanoic acid.

Molecular Properties

Compound Name3-[hexyl(3-trimethoxysilylpropyl)amino]propanoic acid
PubChem CID150372013
Molecular FormulaC15H33NO5Si
Molecular Weight335.52 g/mol
Exact Mass335.21
IUPAC Name3-[hexyl(3-trimethoxysilylpropyl)amino]propanoic acid
SMILESCCCCCCN(CCC[Si](OC)(OC)OC)CCC(=O)O
InChIInChI=1S/C15H33NO5Si/c1-5-6-7-8-11-16(13-10-15(17)18)12-9-14-22(19-2,20-3)21-4/h5-14H2,1-4H3,(H,17,18)
InChIKeyGXXSZCZQDAUKLO-UHFFFAOYSA-N
XLogP2.61
TPSA68.23 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds15
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500335.52
LogP ≤ 52.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze 3-[hexyl(3-trimethoxysilylpropyl)amino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[hexyl(3-trimethoxysilylpropyl)amino]propanoic acid?
The IUPAC name of 3-[hexyl(3-trimethoxysilylpropyl)amino]propanoic acid (CID 150372013) is 3-[hexyl(3-trimethoxysilylpropyl)amino]propanoic acid.
What is the SMILES notation for 3-[hexyl(3-trimethoxysilylpropyl)amino]propanoic acid?
The canonical SMILES for 3-[hexyl(3-trimethoxysilylpropyl)amino]propanoic acid is CCCCCCN(CCC[Si](OC)(OC)OC)CCC(=O)O.
What is the InChIKey of 3-[hexyl(3-trimethoxysilylpropyl)amino]propanoic acid?
The InChIKey is GXXSZCZQDAUKLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33NO5Si/c1-5-6-7-8-11-16(13-10-15(17)18)12-9-14-22(19-2,20-3)21-4/h5-14H2,1-4H3,(H,17,18).
What are the key properties of 3-[hexyl(3-trimethoxysilylpropyl)amino]propanoic acid?
3-[hexyl(3-trimethoxysilylpropyl)amino]propanoic acid has a molecular weight of 335.52 g/mol, XLogP of 2.61, 15 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[hexyl(3-trimethoxysilylpropyl)amino]propanoic acid is sourced from PubChem (CID 150372013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).