C14H37NO4Si3 — CID 90355331
3-(2-trimethoxysilylethoxy)-N,N-bis(trimethylsilyl)propan-1-amine (PubChem CID 90355331) has the molecular formula C14H37NO4Si3 and a molecular weight of 367.71 g/mol. Its IUPAC name is 3-(2-trimethoxysilylethoxy)-N,N-bis(trimethylsilyl)propan-1-amine.
| Compound Name | 3-(2-trimethoxysilylethoxy)-N,N-bis(trimethylsilyl)propan-1-amine |
|---|---|
| PubChem CID | 90355331 |
| Molecular Formula | C14H37NO4Si3 |
| Molecular Weight | 367.71 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 3-(2-trimethoxysilylethoxy)-N,N-bis(trimethylsilyl)propan-1-amine |
| SMILES | CO[Si](CCOCCCN([Si](C)(C)C)[Si](C)(C)C)(OC)OC |
| InChI | InChI=1S/C14H37NO4Si3/c1-16-22(17-2,18-3)14-13-19-12-10-11-15(20(4,5)6)21(7,8)9/h10-14H2,1-9H3 |
| InChIKey | PKTWNUQJHWKNGZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.71 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|