C12H32O8Si5 — CID 58672213
CID 58672213 (PubChem CID 58672213) has the molecular formula C12H32O8Si5 and a molecular weight of 444.81 g/mol.
| Compound Name | CID 58672213 |
|---|---|
| PubChem CID | 58672213 |
| Molecular Formula | C12H32O8Si5 |
| Molecular Weight | 444.81 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | — |
| SMILES | CO[Si](CCCOCCC[SiH]1O[Si](C)O[SiH](C)O[Si](C)O1)(OC)OC |
| InChI | InChI=1S/C12H32O8Si5/c1-13-25(14-2,15-3)12-8-10-16-9-7-11-24-19-22(5)17-21(4)18-23(6)20-24/h21,24H,7-12H2,1-6H3 |
| InChIKey | YHBPXDWYRWRUHQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.81 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|