C68H164O28Si13 — CID 157122968
3-ethoxypropyl-tris[3-[tris(3-trimethoxysilylpropyl)silyl]propyl]silane (PubChem CID 157122968) has the molecular formula C68H164O28Si13 and a molecular weight of 1795.15 g/mol. Its IUPAC name is 3-ethoxypropyl-tris[3-[tris(3-trimethoxysilylpropyl)silyl]propyl]silane.
| Compound Name | 3-ethoxypropyl-tris[3-[tris(3-trimethoxysilylpropyl)silyl]propyl]silane |
|---|---|
| PubChem CID | 157122968 |
| Molecular Formula | C68H164O28Si13 |
| Molecular Weight | 1795.15 g/mol |
| Exact Mass | 1792.84 |
| IUPAC Name | 3-ethoxypropyl-tris[3-[tris(3-trimethoxysilylpropyl)silyl]propyl]silane |
| SMILES | CCOCCC[Si](CCC[Si](CCC[Si](OC)(OC)OC)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC)(CCC[Si](CCC[Si](OC)(OC)OC)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC)CCC[Si](CCC[Si](OC)(OC)OC)(CCC[Si](OC)(OC)OC)CCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C68H164O28Si13/c1-29-96-43-30-44-97(45-31-48-98(51-34-60-101(69-2,70-3)71-4,52-35-61-102(72-5,73-6)74-7)53-36-62-103(75-8,76-9)77-10,46-32-49-99(54-37-63-104(78-11,79-12)80-13,55-38-64-105(81-14,82-15)83-16)56-39-65-106(84-17,85-18)86-19)47-33-50-100(57-40-66-107(87-20,88-21)89-22,58-41-67-108(90-23,91-24)92-25)59-42-68-109(93-26,94-27)95-28/h29-68H2,1-28H3 |
| InChIKey | KPGXDXJCWYSNMQ-UHFFFAOYSA-N |
| XLogP | 14.79 |
| TPSA | 258.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 28 |
| Rotatable Bonds | 80 |
| Heavy Atoms | 109 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1795.15 |
| LogP ≤ 5 | 14.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 28 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|